1-(4-fluorophenyl)-4-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-2-one
Chemical Structure Depiction of
1-(4-fluorophenyl)-4-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-2-one
1-(4-fluorophenyl)-4-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-2-one
Compound characteristics
| Compound ID: | G229-0083 |
| Compound Name: | 1-(4-fluorophenyl)-4-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-2-one |
| Molecular Weight: | 341.32 |
| Molecular Formula: | C18 H13 F2 N3 O2 |
| Smiles: | C1C(CN(C1=O)c1ccc(cc1)F)c1nc(c2ccccc2F)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6452 |
| logD: | 3.6452 |
| logSw: | -4.0018 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.394 |
| InChI Key: | XKOBTEHQGQATMM-NSHDSACASA-N |