1-(3-chlorophenyl)-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-2-one
Chemical Structure Depiction of
1-(3-chlorophenyl)-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-2-one
1-(3-chlorophenyl)-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-2-one
Compound characteristics
| Compound ID: | G229-0266 |
| Compound Name: | 1-(3-chlorophenyl)-4-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-2-one |
| Molecular Weight: | 429.86 |
| Molecular Formula: | C21 H20 Cl N3 O5 |
| Smiles: | COc1cc(cc(c1OC)OC)c1nc(C2CC(N(C2)c2cccc(c2)[Cl])=O)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0065 |
| logD: | 4.0065 |
| logSw: | -4.3952 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 71.372 |
| InChI Key: | VCWOXTYGRKROFR-CYBMUJFWSA-N |