2-(5,5-dioxo-5lambda~6~-phenothiazin-10(5H)-yl)-N-[(2-methoxyphenyl)methyl]acetamide
Chemical Structure Depiction of
2-(5,5-dioxo-5lambda~6~-phenothiazin-10(5H)-yl)-N-[(2-methoxyphenyl)methyl]acetamide
2-(5,5-dioxo-5lambda~6~-phenothiazin-10(5H)-yl)-N-[(2-methoxyphenyl)methyl]acetamide
Compound characteristics
| Compound ID: | G233-0073 |
| Compound Name: | 2-(5,5-dioxo-5lambda~6~-phenothiazin-10(5H)-yl)-N-[(2-methoxyphenyl)methyl]acetamide |
| Molecular Weight: | 408.47 |
| Molecular Formula: | C22 H20 N2 O4 S |
| Smiles: | COc1ccccc1CNC(CN1c2ccccc2S(c2ccccc12)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3027 |
| logD: | 3.3027 |
| logSw: | -3.7431 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.368 |
| InChI Key: | FZNCKDCFOTYPFO-UHFFFAOYSA-N |