N-[4-({[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl](phenyl)methyl}amino)phenyl]acetamide
Chemical Structure Depiction of
N-[4-({[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl](phenyl)methyl}amino)phenyl]acetamide
N-[4-({[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl](phenyl)methyl}amino)phenyl]acetamide
Compound characteristics
| Compound ID: | G234-0169 |
| Compound Name: | N-[4-({[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl](phenyl)methyl}amino)phenyl]acetamide |
| Molecular Weight: | 418.88 |
| Molecular Formula: | C23 H19 Cl N4 O2 |
| Smiles: | CC(Nc1ccc(cc1)NC(c1ccccc1)c1nnc(c2ccccc2[Cl])o1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.38 |
| logD: | 4.38 |
| logSw: | -4.5212 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.331 |
| InChI Key: | IGLAZVDBBWAKOU-OAQYLSRUSA-N |