N~2~-benzyl-N-cyclopentyl-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)glycinamide
Chemical Structure Depiction of
N~2~-benzyl-N-cyclopentyl-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)glycinamide
N~2~-benzyl-N-cyclopentyl-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | G237-0042 |
| Compound Name: | N~2~-benzyl-N-cyclopentyl-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)glycinamide |
| Molecular Weight: | 443.59 |
| Molecular Formula: | C22 H25 N3 O3 S2 |
| Smiles: | Cc1nc2ccc(cc2s1)S(N(CC(NC1CCCC1)=O)Cc1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1435 |
| logD: | 4.1435 |
| logSw: | -4.2105 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.432 |
| InChI Key: | DQJBGJJLMALORK-UHFFFAOYSA-N |