N~2~-benzyl-N-(2-methoxy-5-methylphenyl)-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)glycinamide
Chemical Structure Depiction of
N~2~-benzyl-N-(2-methoxy-5-methylphenyl)-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)glycinamide
N~2~-benzyl-N-(2-methoxy-5-methylphenyl)-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | G237-0189 |
| Compound Name: | N~2~-benzyl-N-(2-methoxy-5-methylphenyl)-N~2~-(2-methyl-1,3-benzothiazole-6-sulfonyl)glycinamide |
| Molecular Weight: | 495.62 |
| Molecular Formula: | C25 H25 N3 O4 S2 |
| Smiles: | Cc1ccc(c(c1)NC(CN(Cc1ccccc1)S(c1ccc2c(c1)sc(C)n2)(=O)=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.6368 |
| logD: | 4.6341 |
| logSw: | -4.4841 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.951 |
| InChI Key: | IYCINQHMLWBPJE-UHFFFAOYSA-N |