N-(4-chlorophenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)propanamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)propanamide
N-(4-chlorophenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)propanamide
Compound characteristics
| Compound ID: | G239-0433 |
| Compound Name: | N-(4-chlorophenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)propanamide |
| Molecular Weight: | 277.75 |
| Molecular Formula: | C14 H16 Cl N3 O |
| Smiles: | Cc1cc(C)n(CCC(Nc2ccc(cc2)[Cl])=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 2.1456 |
| logD: | 2.1453 |
| logSw: | -3.1749 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.102 |
| InChI Key: | ZMEADTKAYRRCIW-UHFFFAOYSA-N |