N-(2,6-dimethylphenyl)-2,5-dimethyl-4-(piperidine-1-carbonyl)-1H-pyrrole-3-sulfonamide
Chemical Structure Depiction of
N-(2,6-dimethylphenyl)-2,5-dimethyl-4-(piperidine-1-carbonyl)-1H-pyrrole-3-sulfonamide
N-(2,6-dimethylphenyl)-2,5-dimethyl-4-(piperidine-1-carbonyl)-1H-pyrrole-3-sulfonamide
Compound characteristics
| Compound ID: | G242-0452 |
| Compound Name: | N-(2,6-dimethylphenyl)-2,5-dimethyl-4-(piperidine-1-carbonyl)-1H-pyrrole-3-sulfonamide |
| Molecular Weight: | 389.52 |
| Molecular Formula: | C20 H27 N3 O3 S |
| Smiles: | Cc1cccc(C)c1NS(c1c(C(N2CCCCC2)=O)c(C)[nH]c1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9845 |
| logD: | 2.9288 |
| logSw: | -3.2227 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.929 |
| InChI Key: | IJCKICAJAVSGNX-UHFFFAOYSA-N |