N-[2-(cyclohex-1-en-1-yl)ethyl]-6-ethyl-4-oxo-2,3,4,9-tetrahydro-1H-carbazole-7-sulfonamide
Chemical Structure Depiction of
N-[2-(cyclohex-1-en-1-yl)ethyl]-6-ethyl-4-oxo-2,3,4,9-tetrahydro-1H-carbazole-7-sulfonamide
N-[2-(cyclohex-1-en-1-yl)ethyl]-6-ethyl-4-oxo-2,3,4,9-tetrahydro-1H-carbazole-7-sulfonamide
Compound characteristics
| Compound ID: | G261-1219 |
| Compound Name: | N-[2-(cyclohex-1-en-1-yl)ethyl]-6-ethyl-4-oxo-2,3,4,9-tetrahydro-1H-carbazole-7-sulfonamide |
| Molecular Weight: | 400.54 |
| Molecular Formula: | C22 H28 N2 O3 S |
| Smiles: | CCc1cc2c3C(CCCc3[nH]c2cc1S(NCCC1CCCCC=1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1613 |
| logD: | 4.1613 |
| logSw: | -4.235 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.049 |
| InChI Key: | AAYOEZNMCQPWRN-UHFFFAOYSA-N |