N-(4-chloro-2-fluorophenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)butanamide
Chemical Structure Depiction of
N-(4-chloro-2-fluorophenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)butanamide
N-(4-chloro-2-fluorophenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)butanamide
Compound characteristics
| Compound ID: | G262-0579 |
| Compound Name: | N-(4-chloro-2-fluorophenyl)-3-(3,5-dimethyl-1H-pyrazol-1-yl)butanamide |
| Molecular Weight: | 309.77 |
| Molecular Formula: | C15 H17 Cl F N3 O |
| Smiles: | CC(CC(Nc1ccc(cc1F)[Cl])=O)n1c(C)cc(C)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.6511 |
| logD: | 2.613 |
| logSw: | -3.5413 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.478 |
| InChI Key: | XZQALTYBWBPCRX-NSHDSACASA-N |