3-(3,5-dimethyl-1H-pyrazol-1-yl)-N-[(2-methylphenyl)methyl]butanamide
Chemical Structure Depiction of
3-(3,5-dimethyl-1H-pyrazol-1-yl)-N-[(2-methylphenyl)methyl]butanamide
3-(3,5-dimethyl-1H-pyrazol-1-yl)-N-[(2-methylphenyl)methyl]butanamide
Compound characteristics
| Compound ID: | G262-0650 |
| Compound Name: | 3-(3,5-dimethyl-1H-pyrazol-1-yl)-N-[(2-methylphenyl)methyl]butanamide |
| Molecular Weight: | 285.39 |
| Molecular Formula: | C17 H23 N3 O |
| Smiles: | CC(CC(NCc1ccccc1C)=O)n1c(C)cc(C)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5329 |
| logD: | 2.5328 |
| logSw: | -2.6693 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.498 |
| InChI Key: | KAMPNMFGMKTREV-HNNXBMFYSA-N |