N-(2-methylphenyl)-3-(3-methyl-1H-pyrazol-1-yl)butanamide
Chemical Structure Depiction of
N-(2-methylphenyl)-3-(3-methyl-1H-pyrazol-1-yl)butanamide
N-(2-methylphenyl)-3-(3-methyl-1H-pyrazol-1-yl)butanamide
Compound characteristics
| Compound ID: | G262-0896 |
| Compound Name: | N-(2-methylphenyl)-3-(3-methyl-1H-pyrazol-1-yl)butanamide |
| Molecular Weight: | 257.33 |
| Molecular Formula: | C15 H19 N3 O |
| Smiles: | CC(CC(Nc1ccccc1C)=O)n1ccc(C)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7268 |
| logD: | 1.7268 |
| logSw: | -2.0904 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.654 |
| InChI Key: | BVEMWRIBNQOIGC-ZDUSSCGKSA-N |