N-(3-chloro-4-methoxyphenyl)-3-(3-methyl-1H-pyrazol-1-yl)butanamide
Chemical Structure Depiction of
N-(3-chloro-4-methoxyphenyl)-3-(3-methyl-1H-pyrazol-1-yl)butanamide
N-(3-chloro-4-methoxyphenyl)-3-(3-methyl-1H-pyrazol-1-yl)butanamide
Compound characteristics
| Compound ID: | G262-0971 |
| Compound Name: | N-(3-chloro-4-methoxyphenyl)-3-(3-methyl-1H-pyrazol-1-yl)butanamide |
| Molecular Weight: | 307.78 |
| Molecular Formula: | C15 H18 Cl N3 O2 |
| Smiles: | CC(CC(Nc1ccc(c(c1)[Cl])OC)=O)n1ccc(C)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4426 |
| logD: | 2.4412 |
| logSw: | -3.2616 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.982 |
| InChI Key: | GMOPSPUFSPKDHY-NSHDSACASA-N |