(2-methyl-5-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl (4-fluorophenoxy)acetate
Chemical Structure Depiction of
(2-methyl-5-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl (4-fluorophenoxy)acetate
(2-methyl-5-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl (4-fluorophenoxy)acetate
Compound characteristics
| Compound ID: | G265-0525 |
| Compound Name: | (2-methyl-5-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl (4-fluorophenoxy)acetate |
| Molecular Weight: | 348.35 |
| Molecular Formula: | C16 H13 F N2 O4 S |
| Smiles: | CC1=CN2C(=NC(COC(COc3ccc(cc3)F)=O)=CC2=O)S1 |
| Stereo: | ACHIRAL |
| logP: | 1.7218 |
| logD: | 1.7218 |
| logSw: | -2.2113 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 54.474 |
| InChI Key: | UEZGYEUTKXBSFU-UHFFFAOYSA-N |