(2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl (4-chlorophenoxy)acetate
Chemical Structure Depiction of
(2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl (4-chlorophenoxy)acetate
(2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl (4-chlorophenoxy)acetate
Compound characteristics
| Compound ID: | G265-0775 |
| Compound Name: | (2-methyl-7-oxo-7H-[1,2]oxazolo[2,3-a]pyrimidin-5-yl)methyl (4-chlorophenoxy)acetate |
| Molecular Weight: | 348.74 |
| Molecular Formula: | C16 H13 Cl N2 O5 |
| Smiles: | CC1=CC2=NC(COC(COc3ccc(cc3)[Cl])=O)=CC(N2O1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.6959 |
| logD: | 1.6959 |
| logSw: | -2.5859 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 66.464 |
| InChI Key: | UCJPPWIZEBUOHK-UHFFFAOYSA-N |