N-[(4-methylphenyl)methyl]-1-[6-(thiophen-2-yl)pyridazin-3-yl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-[(4-methylphenyl)methyl]-1-[6-(thiophen-2-yl)pyridazin-3-yl]piperidine-4-carboxamide
N-[(4-methylphenyl)methyl]-1-[6-(thiophen-2-yl)pyridazin-3-yl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | G274-0074 |
| Compound Name: | N-[(4-methylphenyl)methyl]-1-[6-(thiophen-2-yl)pyridazin-3-yl]piperidine-4-carboxamide |
| Molecular Weight: | 392.52 |
| Molecular Formula: | C22 H24 N4 O S |
| Smiles: | Cc1ccc(CNC(C2CCN(CC2)c2ccc(c3cccs3)nn2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.7217 |
| logD: | 3.7216 |
| logSw: | -3.7455 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.057 |
| InChI Key: | MEULPXGUNQTVME-UHFFFAOYSA-N |