5-(3,4-dimethyl-1H-pyrazol-5-yl)-N-(2-fluorophenyl)thiophene-2-sulfonamide
Chemical Structure Depiction of
5-(3,4-dimethyl-1H-pyrazol-5-yl)-N-(2-fluorophenyl)thiophene-2-sulfonamide
5-(3,4-dimethyl-1H-pyrazol-5-yl)-N-(2-fluorophenyl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | G275-1267 |
| Compound Name: | 5-(3,4-dimethyl-1H-pyrazol-5-yl)-N-(2-fluorophenyl)thiophene-2-sulfonamide |
| Molecular Weight: | 351.42 |
| Molecular Formula: | C15 H14 F N3 O2 S2 |
| Smiles: | Cc1c(C)n[nH]c1c1ccc(s1)S(Nc1ccccc1F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6658 |
| logD: | 3.3721 |
| logSw: | -3.9241 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.046 |
| InChI Key: | RNSHHKUEVUFOQO-UHFFFAOYSA-N |