N-methyl-N-(3-methylphenyl)-5-[3-(trifluoromethyl)-1H-pyrazol-5-yl]thiophene-2-sulfonamide
Chemical Structure Depiction of
N-methyl-N-(3-methylphenyl)-5-[3-(trifluoromethyl)-1H-pyrazol-5-yl]thiophene-2-sulfonamide
N-methyl-N-(3-methylphenyl)-5-[3-(trifluoromethyl)-1H-pyrazol-5-yl]thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | G275-1832 |
| Compound Name: | N-methyl-N-(3-methylphenyl)-5-[3-(trifluoromethyl)-1H-pyrazol-5-yl]thiophene-2-sulfonamide |
| Molecular Weight: | 401.43 |
| Molecular Formula: | C16 H14 F3 N3 O2 S2 |
| Smiles: | Cc1cccc(c1)N(C)S(c1ccc(c2cc(C(F)(F)F)n[nH]2)s1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8269 |
| logD: | 4.8269 |
| logSw: | -4.6507 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.568 |
| InChI Key: | YUKAUGCCNSCNRD-UHFFFAOYSA-N |