N-(5-chloro-2,4-dimethoxyphenyl)-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(5-chloro-2,4-dimethoxyphenyl)-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide
N-(5-chloro-2,4-dimethoxyphenyl)-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | G275-2065 |
| Compound Name: | N-(5-chloro-2,4-dimethoxyphenyl)-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 399.87 |
| Molecular Formula: | C15 H14 Cl N3 O4 S2 |
| Smiles: | COc1cc(c(cc1NS(c1ccc(c2ccn[nH]2)s1)(=O)=O)[Cl])OC |
| Stereo: | ACHIRAL |
| logP: | 3.6761 |
| logD: | 1.9274 |
| logSw: | -3.9596 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.799 |
| InChI Key: | RJBYZIBAOXVBHB-UHFFFAOYSA-N |