N-[3-(1,2-oxazol-5-yl)phenyl]-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-[3-(1,2-oxazol-5-yl)phenyl]-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide
N-[3-(1,2-oxazol-5-yl)phenyl]-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | G275-2268 |
| Compound Name: | N-[3-(1,2-oxazol-5-yl)phenyl]-5-(1H-pyrazol-5-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 372.42 |
| Molecular Formula: | C16 H12 N4 O3 S2 |
| Smiles: | c1cc(cc(c1)NS(c1ccc(c2ccn[nH]2)s1)(=O)=O)c1ccno1 |
| Stereo: | ACHIRAL |
| logP: | 3.2796 |
| logD: | 3.2789 |
| logSw: | -3.5337 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.105 |
| InChI Key: | PWJCSHIZAIXHGI-UHFFFAOYSA-N |