N-[(2-ethoxyphenyl)methyl]-2-(3-methyl-5-oxo-1-phenyl-5,6-dihydropyrazolo[3,4-b][1,4]thiazin-4(1H)-yl)acetamide
					Chemical Structure Depiction of
N-[(2-ethoxyphenyl)methyl]-2-(3-methyl-5-oxo-1-phenyl-5,6-dihydropyrazolo[3,4-b][1,4]thiazin-4(1H)-yl)acetamide
			N-[(2-ethoxyphenyl)methyl]-2-(3-methyl-5-oxo-1-phenyl-5,6-dihydropyrazolo[3,4-b][1,4]thiazin-4(1H)-yl)acetamide
Compound characteristics
| Compound ID: | G279-0172 | 
| Compound Name: | N-[(2-ethoxyphenyl)methyl]-2-(3-methyl-5-oxo-1-phenyl-5,6-dihydropyrazolo[3,4-b][1,4]thiazin-4(1H)-yl)acetamide | 
| Molecular Weight: | 436.53 | 
| Molecular Formula: | C23 H24 N4 O3 S | 
| Smiles: | CCOc1ccccc1CNC(CN1C(CSc2c1c(C)nn2c1ccccc1)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 3.0979 | 
| logD: | 3.0979 | 
| logSw: | -3.2455 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 61.25 | 
| InChI Key: | WJZROCPKLVOURU-UHFFFAOYSA-N | 
 
				 
				