N~1~-[(4-fluorophenyl)methyl]-6-methyl-N~6~-[(4-methylphenyl)methyl]-8-oxo-7-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1,6-dicarboxamide
Chemical Structure Depiction of
N~1~-[(4-fluorophenyl)methyl]-6-methyl-N~6~-[(4-methylphenyl)methyl]-8-oxo-7-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1,6-dicarboxamide
N~1~-[(4-fluorophenyl)methyl]-6-methyl-N~6~-[(4-methylphenyl)methyl]-8-oxo-7-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1,6-dicarboxamide
Compound characteristics
| Compound ID: | G282-0832 |
| Compound Name: | N~1~-[(4-fluorophenyl)methyl]-6-methyl-N~6~-[(4-methylphenyl)methyl]-8-oxo-7-propyl-5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1,6-dicarboxamide |
| Molecular Weight: | 491.57 |
| Molecular Formula: | C27 H30 F N5 O3 |
| Smiles: | CCCN1C(c2c(C(NCc3ccc(cc3)F)=O)ncn2CC1(C)C(NCc1ccc(C)cc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8936 |
| logD: | 2.8936 |
| logSw: | -3.0872 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 76.348 |
| InChI Key: | FSXCVRJYOJQOFH-MHZLTWQESA-N |