2-[3-(benzenesulfonyl)-7-methyl-4-oxo-1,8-naphthyridin-1(4H)-yl]-N-cyclopentylacetamide
Chemical Structure Depiction of
2-[3-(benzenesulfonyl)-7-methyl-4-oxo-1,8-naphthyridin-1(4H)-yl]-N-cyclopentylacetamide
2-[3-(benzenesulfonyl)-7-methyl-4-oxo-1,8-naphthyridin-1(4H)-yl]-N-cyclopentylacetamide
Compound characteristics
| Compound ID: | G313-0056 |
| Compound Name: | 2-[3-(benzenesulfonyl)-7-methyl-4-oxo-1,8-naphthyridin-1(4H)-yl]-N-cyclopentylacetamide |
| Molecular Weight: | 425.51 |
| Molecular Formula: | C22 H23 N3 O4 S |
| Smiles: | Cc1ccc2C(C(=CN(CC(NC3CCCC3)=O)c2n1)S(c1ccccc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2784 |
| logD: | 3.2784 |
| logSw: | -3.9215 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 79.331 |
| InChI Key: | MWPNAABJHATEPE-UHFFFAOYSA-N |