3-ethoxy-4-(2-methoxyanilino)cyclobut-3-ene-1,2-dione
					Chemical Structure Depiction of
3-ethoxy-4-(2-methoxyanilino)cyclobut-3-ene-1,2-dione
			3-ethoxy-4-(2-methoxyanilino)cyclobut-3-ene-1,2-dione
Compound characteristics
| Compound ID: | G317-0223 | 
| Compound Name: | 3-ethoxy-4-(2-methoxyanilino)cyclobut-3-ene-1,2-dione | 
| Molecular Weight: | 247.25 | 
| Molecular Formula: | C13 H13 N O4 | 
| Smiles: | CCOC1=C(C(C1=O)=O)Nc1ccccc1OC | 
| Stereo: | ACHIRAL | 
| logP: | 2.139 | 
| logD: | 2.0913 | 
| logSw: | -2.7418 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 50.54 | 
| InChI Key: | HTUYTMFUWNJKDQ-UHFFFAOYSA-N | 
 
				 
				