3-hydroxy-4-{[(2-methoxyphenyl)methyl]amino}cyclobut-3-ene-1,2-dione
Chemical Structure Depiction of
3-hydroxy-4-{[(2-methoxyphenyl)methyl]amino}cyclobut-3-ene-1,2-dione
3-hydroxy-4-{[(2-methoxyphenyl)methyl]amino}cyclobut-3-ene-1,2-dione
Compound characteristics
| Compound ID: | G317-0541 |
| Compound Name: | 3-hydroxy-4-{[(2-methoxyphenyl)methyl]amino}cyclobut-3-ene-1,2-dione |
| Molecular Weight: | 233.22 |
| Molecular Formula: | C12 H11 N O4 |
| Smiles: | COc1ccccc1CNC1=C(C(C1=O)=O)O |
| Stereo: | ACHIRAL |
| logP: | 0.7197 |
| logD: | -4.0909 |
| logSw: | -1.8142 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 60.19 |
| InChI Key: | LMISGYSKLWELIO-UHFFFAOYSA-N |