1-[3-methyl-5-(2-phenylethenyl)-1,2-oxazole-4-sulfonyl]-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide
Chemical Structure Depiction of
1-[3-methyl-5-(2-phenylethenyl)-1,2-oxazole-4-sulfonyl]-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide
1-[3-methyl-5-(2-phenylethenyl)-1,2-oxazole-4-sulfonyl]-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | G323-0457 |
| Compound Name: | 1-[3-methyl-5-(2-phenylethenyl)-1,2-oxazole-4-sulfonyl]-N-[(4-methylphenyl)methyl]piperidine-3-carboxamide |
| Molecular Weight: | 479.6 |
| Molecular Formula: | C26 H29 N3 O4 S |
| Smiles: | Cc1ccc(CNC(C2CCCN(C2)S(c2c(C)noc2/C=C/c2ccccc2)(=O)=O)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5811 |
| logD: | 3.5811 |
| logSw: | -3.6793 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.812 |
| InChI Key: | UTNFTPGJBKMTIM-QHCPKHFHSA-N |