N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-phenylurea
Chemical Structure Depiction of
N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-phenylurea
N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-phenylurea
Compound characteristics
| Compound ID: | G331-0006 |
| Compound Name: | N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-phenylurea |
| Molecular Weight: | 305.38 |
| Molecular Formula: | C19 H19 N3 O |
| Smiles: | C(c1cccn1Cc1ccccc1)NC(Nc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6176 |
| logD: | 3.6176 |
| logSw: | -3.5922 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 35.934 |
| InChI Key: | OTJUEAHKZUSHSC-UHFFFAOYSA-N |