N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-(4-chlorophenyl)urea
Chemical Structure Depiction of
N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-(4-chlorophenyl)urea
N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-(4-chlorophenyl)urea
Compound characteristics
| Compound ID: | G331-0008 |
| Compound Name: | N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-(4-chlorophenyl)urea |
| Molecular Weight: | 339.82 |
| Molecular Formula: | C19 H18 Cl N3 O |
| Smiles: | C(c1cccn1Cc1ccccc1)NC(Nc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.4041 |
| logD: | 4.4041 |
| logSw: | -4.8317 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 35.934 |
| InChI Key: | KPZGLJSFEFPFEK-UHFFFAOYSA-N |