N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-(2,5-dimethylphenyl)urea
Chemical Structure Depiction of
N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-(2,5-dimethylphenyl)urea
N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-(2,5-dimethylphenyl)urea
Compound characteristics
| Compound ID: | G331-0013 |
| Compound Name: | N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-(2,5-dimethylphenyl)urea |
| Molecular Weight: | 333.43 |
| Molecular Formula: | C21 H23 N3 O |
| Smiles: | Cc1ccc(C)c(c1)NC(NCc1cccn1Cc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8515 |
| logD: | 3.8515 |
| logSw: | -3.8056 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 35.236 |
| InChI Key: | RCGKIIKLVLSWAQ-UHFFFAOYSA-N |