N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-[2-(trifluoromethyl)phenyl]urea
Chemical Structure Depiction of
N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-[2-(trifluoromethyl)phenyl]urea
N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-[2-(trifluoromethyl)phenyl]urea
Compound characteristics
| Compound ID: | G331-0039 |
| Compound Name: | N-[(1-benzyl-1H-pyrrol-2-yl)methyl]-N'-[2-(trifluoromethyl)phenyl]urea |
| Molecular Weight: | 373.38 |
| Molecular Formula: | C20 H18 F3 N3 O |
| Smiles: | C(c1cccn1Cc1ccccc1)NC(Nc1ccccc1C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3259 |
| logD: | 4.3259 |
| logSw: | -4.5013 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 35.236 |
| InChI Key: | JHCPSZYURXOVBX-UHFFFAOYSA-N |