N-(4-bromo-2-fluorophenyl)-N'-({1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}methyl)urea
Chemical Structure Depiction of
N-(4-bromo-2-fluorophenyl)-N'-({1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}methyl)urea
N-(4-bromo-2-fluorophenyl)-N'-({1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}methyl)urea
Compound characteristics
| Compound ID: | G331-0271 |
| Compound Name: | N-(4-bromo-2-fluorophenyl)-N'-({1-[(4-fluorophenyl)methyl]-1H-pyrrol-2-yl}methyl)urea |
| Molecular Weight: | 420.25 |
| Molecular Formula: | C19 H16 Br F2 N3 O |
| Smiles: | C(c1cccn1Cc1ccc(cc1)F)NC(Nc1ccc(cc1F)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.5199 |
| logD: | 4.5192 |
| logSw: | -4.3655 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 35.236 |
| InChI Key: | VAFDFEIQMYRGPA-UHFFFAOYSA-N |