N-({1-[(2,5-dimethylphenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(4-fluorophenyl)urea
Chemical Structure Depiction of
N-({1-[(2,5-dimethylphenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(4-fluorophenyl)urea
N-({1-[(2,5-dimethylphenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(4-fluorophenyl)urea
Compound characteristics
| Compound ID: | G331-0360 |
| Compound Name: | N-({1-[(2,5-dimethylphenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(4-fluorophenyl)urea |
| Molecular Weight: | 351.42 |
| Molecular Formula: | C21 H22 F N3 O |
| Smiles: | Cc1ccc(C)c(Cn2cccc2CNC(Nc2ccc(cc2)F)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.049 |
| logD: | 5.049 |
| logSw: | -4.619 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 35.934 |
| InChI Key: | DVRDFZKXKZXCOS-UHFFFAOYSA-N |