methyl 2-[({1-[(2,4,6-trimethylphenyl)methyl]-1H-pyrrol-2-yl}methyl)carbamamido]benzoate
Chemical Structure Depiction of
methyl 2-[({1-[(2,4,6-trimethylphenyl)methyl]-1H-pyrrol-2-yl}methyl)carbamamido]benzoate
methyl 2-[({1-[(2,4,6-trimethylphenyl)methyl]-1H-pyrrol-2-yl}methyl)carbamamido]benzoate
Compound characteristics
| Compound ID: | G331-0406 |
| Compound Name: | methyl 2-[({1-[(2,4,6-trimethylphenyl)methyl]-1H-pyrrol-2-yl}methyl)carbamamido]benzoate |
| Molecular Weight: | 405.5 |
| Molecular Formula: | C24 H27 N3 O3 |
| Smiles: | Cc1cc(C)c(Cn2cccc2CNC(Nc2ccccc2C(=O)OC)=O)c(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 5.1024 |
| logD: | 5.1013 |
| logSw: | -4.8045 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.41 |
| InChI Key: | MWRMXFDSKXVJTB-UHFFFAOYSA-N |