N-({1-[(4-chlorophenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(3-methylbutyl)urea
Chemical Structure Depiction of
N-({1-[(4-chlorophenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(3-methylbutyl)urea
N-({1-[(4-chlorophenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(3-methylbutyl)urea
Compound characteristics
| Compound ID: | G331-0632 |
| Compound Name: | N-({1-[(4-chlorophenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(3-methylbutyl)urea |
| Molecular Weight: | 333.86 |
| Molecular Formula: | C18 H24 Cl N3 O |
| Smiles: | CC(C)CCNC(NCc1cccn1Cc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.9211 |
| logD: | 3.9211 |
| logSw: | -4.3935 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 37.369 |
| InChI Key: | LWAAEAVRSMGALX-UHFFFAOYSA-N |