N-({1-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(4-methoxyphenyl)urea
Chemical Structure Depiction of
N-({1-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(4-methoxyphenyl)urea
N-({1-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(4-methoxyphenyl)urea
Compound characteristics
| Compound ID: | G331-0656 |
| Compound Name: | N-({1-[(2-fluorophenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-(4-methoxyphenyl)urea |
| Molecular Weight: | 353.39 |
| Molecular Formula: | C20 H20 F N3 O2 |
| Smiles: | COc1ccc(cc1)NC(NCc1cccn1Cc1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0967 |
| logD: | 4.0967 |
| logSw: | -4.1978 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 43.478 |
| InChI Key: | AHVSRUJCVWCYOE-UHFFFAOYSA-N |