ethyl {4-[({1-[(2-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)carbamamido]phenyl}acetate
Chemical Structure Depiction of
ethyl {4-[({1-[(2-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)carbamamido]phenyl}acetate
ethyl {4-[({1-[(2-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)carbamamido]phenyl}acetate
Compound characteristics
| Compound ID: | G331-0828 |
| Compound Name: | ethyl {4-[({1-[(2-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)carbamamido]phenyl}acetate |
| Molecular Weight: | 405.5 |
| Molecular Formula: | C24 H27 N3 O3 |
| Smiles: | CCOC(Cc1ccc(cc1)NC(NCc1cccn1Cc1ccccc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6478 |
| logD: | 4.6478 |
| logSw: | -4.2295 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 56.093 |
| InChI Key: | YJIQAWNTGGBZFT-UHFFFAOYSA-N |