N-({1-[(2-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-[2-(trifluoromethyl)phenyl]urea
Chemical Structure Depiction of
N-({1-[(2-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-[2-(trifluoromethyl)phenyl]urea
N-({1-[(2-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-[2-(trifluoromethyl)phenyl]urea
Compound characteristics
| Compound ID: | G331-0829 |
| Compound Name: | N-({1-[(2-methylphenyl)methyl]-1H-pyrrol-2-yl}methyl)-N'-[2-(trifluoromethyl)phenyl]urea |
| Molecular Weight: | 387.4 |
| Molecular Formula: | C21 H20 F3 N3 O |
| Smiles: | Cc1ccccc1Cn1cccc1CNC(Nc1ccccc1C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1091 |
| logD: | 5.1091 |
| logSw: | -4.8453 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 35.236 |
| InChI Key: | JQEQPQDFUAZECY-UHFFFAOYSA-N |