N-[(5-bromo-2-methoxyphenyl)methyl]-5-(2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazin-1-yl)thiophene-2-carboxamide
Chemical Structure Depiction of
N-[(5-bromo-2-methoxyphenyl)methyl]-5-(2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazin-1-yl)thiophene-2-carboxamide
N-[(5-bromo-2-methoxyphenyl)methyl]-5-(2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazin-1-yl)thiophene-2-carboxamide
Compound characteristics
| Compound ID: | G332-0447 |
| Compound Name: | N-[(5-bromo-2-methoxyphenyl)methyl]-5-(2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazin-1-yl)thiophene-2-carboxamide |
| Molecular Weight: | 476.41 |
| Molecular Formula: | C20 H18 Br N3 O2 S2 |
| Smiles: | COc1ccc(cc1CNC(c1ccc(N2CCSc3c2cccn3)s1)=O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.6535 |
| logD: | 4.6535 |
| logSw: | -4.3344 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.821 |
| InChI Key: | XXGPNXWTQDESKT-UHFFFAOYSA-N |