6-{[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy}-1-(3-fluorophenyl)-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridine
Chemical Structure Depiction of
6-{[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy}-1-(3-fluorophenyl)-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridine
6-{[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy}-1-(3-fluorophenyl)-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridine
Compound characteristics
| Compound ID: | G334-0011 |
| Compound Name: | 6-{[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy}-1-(3-fluorophenyl)-3,4-dimethyl-1H-pyrazolo[3,4-b]pyridine |
| Molecular Weight: | 488.52 |
| Molecular Formula: | C27 H25 F N4 O4 |
| Smiles: | Cc1cc(nc2c1c(C)nn2c1cccc(c1)F)OCc1c(C)oc(c2ccc(c(c2)OC)OC)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.2065 |
| logD: | 5.2065 |
| logSw: | -5.3605 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 64.145 |
| InChI Key: | LQQPXSXYZHDROK-UHFFFAOYSA-N |