3,4-dimethyl-6-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy}-1-phenyl-1H-pyrazolo[3,4-b]pyridine
Chemical Structure Depiction of
3,4-dimethyl-6-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy}-1-phenyl-1H-pyrazolo[3,4-b]pyridine
3,4-dimethyl-6-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy}-1-phenyl-1H-pyrazolo[3,4-b]pyridine
Compound characteristics
| Compound ID: | G334-0158 |
| Compound Name: | 3,4-dimethyl-6-{[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy}-1-phenyl-1H-pyrazolo[3,4-b]pyridine |
| Molecular Weight: | 424.5 |
| Molecular Formula: | C26 H24 N4 O2 |
| Smiles: | Cc1ccc(cc1)c1nc(COc2cc(C)c3c(C)nn(c4ccccc4)c3n2)c(C)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.8939 |
| logD: | 5.8939 |
| logSw: | -5.9519 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.884 |
| InChI Key: | VWWNDGXXDZQPSN-UHFFFAOYSA-N |