6-[(2,5-dimethylphenyl)methoxy]-3-methyl-1-(4-methylphenyl)-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine
Chemical Structure Depiction of
6-[(2,5-dimethylphenyl)methoxy]-3-methyl-1-(4-methylphenyl)-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine
6-[(2,5-dimethylphenyl)methoxy]-3-methyl-1-(4-methylphenyl)-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine
Compound characteristics
| Compound ID: | G334-0359 |
| Compound Name: | 6-[(2,5-dimethylphenyl)methoxy]-3-methyl-1-(4-methylphenyl)-4-(trifluoromethyl)-1H-pyrazolo[3,4-b]pyridine |
| Molecular Weight: | 425.45 |
| Molecular Formula: | C24 H22 F3 N3 O |
| Smiles: | Cc1ccc(cc1)n1c2c(c(cc(n2)OCc2cc(C)ccc2C)C(F)(F)F)c(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 7.0489 |
| logD: | 7.0489 |
| logSw: | -6.0707 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 30.7621 |
| InChI Key: | GVFZJXMENFTJEH-UHFFFAOYSA-N |