6-{[2-(2,3-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy}-3,4-dimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridine
Chemical Structure Depiction of
6-{[2-(2,3-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy}-3,4-dimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridine
6-{[2-(2,3-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy}-3,4-dimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridine
Compound characteristics
| Compound ID: | G334-0424 |
| Compound Name: | 6-{[2-(2,3-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methoxy}-3,4-dimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridine |
| Molecular Weight: | 484.55 |
| Molecular Formula: | C28 H28 N4 O4 |
| Smiles: | Cc1ccc(cc1)n1c2c(c(C)cc(n2)OCc2c(C)oc(c3cccc(c3OC)OC)n2)c(C)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.7837 |
| logD: | 5.7837 |
| logSw: | -5.9809 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 64.232 |
| InChI Key: | ZGZJYSHGSLQZGX-UHFFFAOYSA-N |