N-[2-(furan-2-yl)ethyl]-4-oxo-4-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]butanamide
Chemical Structure Depiction of
N-[2-(furan-2-yl)ethyl]-4-oxo-4-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]butanamide
N-[2-(furan-2-yl)ethyl]-4-oxo-4-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]butanamide
Compound characteristics
| Compound ID: | G336-0526 |
| Compound Name: | N-[2-(furan-2-yl)ethyl]-4-oxo-4-[4-([1,3]thiazolo[5,4-b]pyridin-2-yl)piperazin-1-yl]butanamide |
| Molecular Weight: | 413.5 |
| Molecular Formula: | C20 H23 N5 O3 S |
| Smiles: | C(CC(N1CCN(CC1)c1nc2cccnc2s1)=O)C(NCCc1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.2348 |
| logD: | 1.2347 |
| logSw: | -2.0701 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.622 |
| InChI Key: | YCCBXJMWLCODNB-UHFFFAOYSA-N |