N-(3,4-dimethylphenyl)-2-{6-[(2-methylphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-2-{6-[(2-methylphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide
N-(3,4-dimethylphenyl)-2-{6-[(2-methylphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide
Compound characteristics
| Compound ID: | G348-0584 |
| Compound Name: | N-(3,4-dimethylphenyl)-2-{6-[(2-methylphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide |
| Molecular Weight: | 401.53 |
| Molecular Formula: | C21 H27 N3 O3 S |
| Smiles: | Cc1ccc(cc1C)NC(CN1CCCN(Cc2ccccc2C)S1(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1767 |
| logD: | 4.1766 |
| logSw: | -4.0708 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.528 |
| InChI Key: | RGSHQIKDGKSHLD-UHFFFAOYSA-N |