N-(3-chlorophenyl)-2-{6-[(4-methoxyphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-2-{6-[(4-methoxyphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide
N-(3-chlorophenyl)-2-{6-[(4-methoxyphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide
Compound characteristics
| Compound ID: | G348-0790 |
| Compound Name: | N-(3-chlorophenyl)-2-{6-[(4-methoxyphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide |
| Molecular Weight: | 423.92 |
| Molecular Formula: | C19 H22 Cl N3 O4 S |
| Smiles: | COc1ccc(CN2CCCN(CC(Nc3cccc(c3)[Cl])=O)S2(=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.1746 |
| logD: | 3.1745 |
| logSw: | -3.535 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.072 |
| InChI Key: | NFNOYZOYKOACER-UHFFFAOYSA-N |