N~1~-ethyl-N~3~-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N~1~-phenylpropane-1,3-diamine
Chemical Structure Depiction of
N~1~-ethyl-N~3~-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N~1~-phenylpropane-1,3-diamine
N~1~-ethyl-N~3~-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N~1~-phenylpropane-1,3-diamine
Compound characteristics
| Compound ID: | G349-0770 |
| Compound Name: | N~1~-ethyl-N~3~-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]-N~1~-phenylpropane-1,3-diamine |
| Molecular Weight: | 340.4 |
| Molecular Formula: | C19 H21 F N4 O |
| Smiles: | CCN(CCCNc1nc(c2ccccc2F)no1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.2597 |
| logD: | 4.2454 |
| logSw: | -4.1435 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.294 |
| InChI Key: | QRGBIUJOWAXEHE-UHFFFAOYSA-N |