N-[(3-chlorophenyl)methyl]-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-amine
Chemical Structure Depiction of
N-[(3-chlorophenyl)methyl]-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-amine
N-[(3-chlorophenyl)methyl]-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-amine
Compound characteristics
| Compound ID: | G349-1800 |
| Compound Name: | N-[(3-chlorophenyl)methyl]-3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-amine |
| Molecular Weight: | 345.78 |
| Molecular Formula: | C17 H16 Cl N3 O3 |
| Smiles: | COc1cccc(c1OC)c1nc(NCc2cccc(c2)[Cl])on1 |
| Stereo: | ACHIRAL |
| logP: | 3.8732 |
| logD: | 3.8732 |
| logSw: | -4.2684 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.811 |
| InChI Key: | HRFGYWDLJPIKSD-UHFFFAOYSA-N |