N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyrimidin-3-amine
Chemical Structure Depiction of
N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyrimidin-3-amine
N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyrimidin-3-amine
Compound characteristics
| Compound ID: | G350-0104 |
| Compound Name: | N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyrimidin-3-amine |
| Molecular Weight: | 310.37 |
| Molecular Formula: | C18 H19 F N4 |
| Smiles: | C1CCC(CC1)Nc1c(c2cccc(c2)F)nc2ncccn12 |
| Stereo: | ACHIRAL |
| logP: | 3.7584 |
| logD: | 3.6655 |
| logSw: | -4.0108 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.2022 |
| InChI Key: | YPIHDGARWXAJFX-UHFFFAOYSA-N |