N-[(4-fluorophenyl)methyl]-2-(3-methoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-2-(3-methoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine
N-[(4-fluorophenyl)methyl]-2-(3-methoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine
Compound characteristics
| Compound ID: | G350-0150 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-2-(3-methoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine |
| Molecular Weight: | 348.38 |
| Molecular Formula: | C20 H17 F N4 O |
| Smiles: | COc1cccc(c1)c1c(NCc2ccc(cc2)F)n2cccnc2n1 |
| Stereo: | ACHIRAL |
| logP: | 3.2239 |
| logD: | 3.184 |
| logSw: | -3.4107 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.021 |
| InChI Key: | PUPYXQRAQXVNOQ-UHFFFAOYSA-N |