ethyl 2-{2-[4-(4-fluorophenyl)-2-oxo-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]acetamido}benzoate
Chemical Structure Depiction of
ethyl 2-{2-[4-(4-fluorophenyl)-2-oxo-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]acetamido}benzoate
ethyl 2-{2-[4-(4-fluorophenyl)-2-oxo-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]acetamido}benzoate
Compound characteristics
| Compound ID: | G353-0182 |
| Compound Name: | ethyl 2-{2-[4-(4-fluorophenyl)-2-oxo-2,3-dihydro-1H-1,5-benzodiazepin-1-yl]acetamido}benzoate |
| Molecular Weight: | 459.48 |
| Molecular Formula: | C26 H22 F N3 O4 |
| Smiles: | CCOC(c1ccccc1NC(CN1C(CC(c2ccc(cc2)F)=Nc2ccccc12)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.348 |
| logD: | 4.3217 |
| logSw: | -4.2539 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.795 |
| InChI Key: | BQKOACIDGPWLJI-UHFFFAOYSA-N |